C12H9BrFNO4S2 — CID 43362608
5-bromo-4-[(3-fluorophenyl)methylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 43362608) has the molecular formula C12H9BrFNO4S2 and a molecular weight of 394.24 g/mol. Its IUPAC name is 5-bromo-4-[(3-fluorophenyl)methylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-bromo-4-[(3-fluorophenyl)methylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43362608 |
| Molecular Formula | C12H9BrFNO4S2 |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 392.91 |
| IUPAC Name | 5-bromo-4-[(3-fluorophenyl)methylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCc2cccc(F)c2)c(Br)s1 |
| InChI | InChI=1S/C12H9BrFNO4S2/c13-11-10(5-9(20-11)12(16)17)21(18,19)15-6-7-2-1-3-8(14)4-7/h1-5,15H,6H2,(H,16,17) |
| InChIKey | NSCOIARIBYSUQR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |