C14H11BrFNO4S — CID 9160148
3-[(3-bromophenyl)methylsulfamoyl]-4-fluorobenzoic acid (PubChem CID 9160148) has the molecular formula C14H11BrFNO4S and a molecular weight of 388.21 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methylsulfamoyl]-4-fluorobenzoic acid.
| Compound Name | 3-[(3-bromophenyl)methylsulfamoyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 9160148 |
| Molecular Formula | C14H11BrFNO4S |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | 3-[(3-bromophenyl)methylsulfamoyl]-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(S(=O)(=O)NCc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C14H11BrFNO4S/c15-11-3-1-2-9(6-11)8-17-22(20,21)13-7-10(14(18)19)4-5-12(13)16/h1-7,17H,8H2,(H,18,19) |
| InChIKey | BIWSRNFFIXDNEA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |