C9H8F3NO4S — CID 113303553
3-(2,2-difluoroethylsulfamoyl)-4-fluorobenzoic acid (PubChem CID 113303553) has the molecular formula C9H8F3NO4S and a molecular weight of 283.23 g/mol. Its IUPAC name is 3-(2,2-difluoroethylsulfamoyl)-4-fluorobenzoic acid.
| Compound Name | 3-(2,2-difluoroethylsulfamoyl)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 113303553 |
| Molecular Formula | C9H8F3NO4S |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 3-(2,2-difluoroethylsulfamoyl)-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(S(=O)(=O)NCC(F)F)c1 |
| InChI | InChI=1S/C9H8F3NO4S/c10-6-2-1-5(9(14)15)3-7(6)18(16,17)13-4-8(11)12/h1-3,8,13H,4H2,(H,14,15) |
| InChIKey | BEFJYRBBSZHEQD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |