C11H6BrF2NO4S2 — CID 39825113
5-bromo-4-[(3,4-difluorophenyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 39825113) has the molecular formula C11H6BrF2NO4S2 and a molecular weight of 398.21 g/mol. Its IUPAC name is 5-bromo-4-[(3,4-difluorophenyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-bromo-4-[(3,4-difluorophenyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 39825113 |
| Molecular Formula | C11H6BrF2NO4S2 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 396.89 |
| IUPAC Name | 5-bromo-4-[(3,4-difluorophenyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2ccc(F)c(F)c2)c(Br)s1 |
| InChI | InChI=1S/C11H6BrF2NO4S2/c12-10-9(4-8(20-10)11(16)17)21(18,19)15-5-1-2-6(13)7(14)3-5/h1-4,15H,(H,16,17) |
| InChIKey | AASFZZFDNTUVEO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |