C10H14BrNO6S2 — CID 106305253
5-bromo-4-[3-(2-hydroxyethoxy)propylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 106305253) has the molecular formula C10H14BrNO6S2 and a molecular weight of 388.26 g/mol. Its IUPAC name is 5-bromo-4-[3-(2-hydroxyethoxy)propylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-bromo-4-[3-(2-hydroxyethoxy)propylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 106305253 |
| Molecular Formula | C10H14BrNO6S2 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 386.94 |
| IUPAC Name | 5-bromo-4-[3-(2-hydroxyethoxy)propylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCCCOCCO)c(Br)s1 |
| InChI | InChI=1S/C10H14BrNO6S2/c11-9-8(6-7(19-9)10(14)15)20(16,17)12-2-1-4-18-5-3-13/h6,12-13H,1-5H2,(H,14,15) |
| InChIKey | LXPLLBQZIBSMKB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|