C11H17BrN2O4S — CID 106308704
2-amino-5-bromo-N-[3-(2-hydroxyethoxy)propyl]benzenesulfonamide (PubChem CID 106308704) has the molecular formula C11H17BrN2O4S and a molecular weight of 353.24 g/mol. Its IUPAC name is 2-amino-5-bromo-N-[3-(2-hydroxyethoxy)propyl]benzenesulfonamide.
| Compound Name | 2-amino-5-bromo-N-[3-(2-hydroxyethoxy)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106308704 |
| Molecular Formula | C11H17BrN2O4S |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2-amino-5-bromo-N-[3-(2-hydroxyethoxy)propyl]benzenesulfonamide |
| SMILES | Nc1ccc(Br)cc1S(=O)(=O)NCCCOCCO |
| InChI | InChI=1S/C11H17BrN2O4S/c12-9-2-3-10(13)11(8-9)19(16,17)14-4-1-6-18-7-5-15/h2-3,8,14-15H,1,4-7,13H2 |
| InChIKey | YXTFLAJXNCAKTH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|