C12H20N2O4S — CID 106308661
3-amino-N-[3-(2-hydroxyethoxy)propyl]-2-methylbenzenesulfonamide (PubChem CID 106308661) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-amino-N-[3-(2-hydroxyethoxy)propyl]-2-methylbenzenesulfonamide.
| Compound Name | 3-amino-N-[3-(2-hydroxyethoxy)propyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106308661 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-amino-N-[3-(2-hydroxyethoxy)propyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1c(N)cccc1S(=O)(=O)NCCCOCCO |
| InChI | InChI=1S/C12H20N2O4S/c1-10-11(13)4-2-5-12(10)19(16,17)14-6-3-8-18-9-7-15/h2,4-5,14-15H,3,6-9,13H2,1H3 |
| InChIKey | KNDFADMZIJPFFT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|