C10H14BrN3O3S — CID 54888437
4-[(2-amino-5-bromophenyl)sulfonylamino]butanamide (PubChem CID 54888437) has the molecular formula C10H14BrN3O3S and a molecular weight of 336.21 g/mol. Its IUPAC name is 4-[(2-amino-5-bromophenyl)sulfonylamino]butanamide.
| Compound Name | 4-[(2-amino-5-bromophenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 54888437 |
| Molecular Formula | C10H14BrN3O3S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 4-[(2-amino-5-bromophenyl)sulfonylamino]butanamide |
| SMILES | NC(=O)CCCNS(=O)(=O)c1cc(Br)ccc1N |
| InChI | InChI=1S/C10H14BrN3O3S/c11-7-3-4-8(12)9(6-7)18(16,17)14-5-1-2-10(13)15/h3-4,6,14H,1-2,5,12H2,(H2,13,15) |
| InChIKey | SYKDIYXSAFHMCW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|