C7H8BrN3O3S — CID 116646105
(2-amino-5-bromophenyl)sulfonylurea (PubChem CID 116646105) has the molecular formula C7H8BrN3O3S and a molecular weight of 294.13 g/mol. Its IUPAC name is (2-amino-5-bromophenyl)sulfonylurea.
| Compound Name | (2-amino-5-bromophenyl)sulfonylurea |
|---|---|
| PubChem CID | 116646105 |
| Molecular Formula | C7H8BrN3O3S |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 292.95 |
| IUPAC Name | (2-amino-5-bromophenyl)sulfonylurea |
| SMILES | NC(=O)NS(=O)(=O)c1cc(Br)ccc1N |
| InChI | InChI=1S/C7H8BrN3O3S/c8-4-1-2-5(9)6(3-4)15(13,14)11-7(10)12/h1-3H,9H2,(H3,10,11,12) |
| InChIKey | DCHKQKGLSMTOPL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|