C14H23BrN2O2S — CID 63401977
2-amino-5-bromo-N-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide (PubChem CID 63401977) has the molecular formula C14H23BrN2O2S and a molecular weight of 363.32 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide.
| Compound Name | 2-amino-5-bromo-N-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 63401977 |
| Molecular Formula | C14H23BrN2O2S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-amino-5-bromo-N-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide |
| SMILES | CC(C)(C)CC(C)(C)NS(=O)(=O)c1cc(Br)ccc1N |
| InChI | InChI=1S/C14H23BrN2O2S/c1-13(2,3)9-14(4,5)17-20(18,19)12-8-10(15)6-7-11(12)16/h6-8,17H,9,16H2,1-5H3 |
| InChIKey | MEXGXYPZLXMNLF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|