C14H21BrFNO2S — CID 116528229
4-bromo-2-fluoro-N-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide (PubChem CID 116528229) has the molecular formula C14H21BrFNO2S and a molecular weight of 366.30 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide.
| Compound Name | 4-bromo-2-fluoro-N-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 116528229 |
| Molecular Formula | C14H21BrFNO2S |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 4-bromo-2-fluoro-N-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide |
| SMILES | CC(C)(C)CC(C)(C)NS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C14H21BrFNO2S/c1-13(2,3)9-14(4,5)17-20(18,19)12-7-6-10(15)8-11(12)16/h6-8,17H,9H2,1-5H3 |
| InChIKey | GCVMZRJMGKGZAC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |