C10H14BrNO5S2 — CID 66089672
5-bromo-4-[(4-hydroxy-2-methylbutyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 66089672) has the molecular formula C10H14BrNO5S2 and a molecular weight of 372.26 g/mol. Its IUPAC name is 5-bromo-4-[(4-hydroxy-2-methylbutyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-bromo-4-[(4-hydroxy-2-methylbutyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 66089672 |
| Molecular Formula | C10H14BrNO5S2 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 370.95 |
| IUPAC Name | 5-bromo-4-[(4-hydroxy-2-methylbutyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | CC(CCO)CNS(=O)(=O)c1cc(C(=O)O)sc1Br |
| InChI | InChI=1S/C10H14BrNO5S2/c1-6(2-3-13)5-12-19(16,17)8-4-7(10(14)15)18-9(8)11/h4,6,12-13H,2-3,5H2,1H3,(H,14,15) |
| InChIKey | KBMPFZNOKRFASO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |