C9H12BrNO5S2 — CID 83030015
methyl 5-bromo-4-[[(2R)-2-hydroxypropyl]sulfamoyl]thiophene-2-carboxylate (PubChem CID 83030015) has the molecular formula C9H12BrNO5S2 and a molecular weight of 358.24 g/mol. Its IUPAC name is methyl 5-bromo-4-[[(2R)-2-hydroxypropyl]sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-bromo-4-[[(2R)-2-hydroxypropyl]sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 83030015 |
| Molecular Formula | C9H12BrNO5S2 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 356.93 |
| IUPAC Name | methyl 5-bromo-4-[[(2R)-2-hydroxypropyl]sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NC[C@@H](C)O)c(Br)s1 |
| InChI | InChI=1S/C9H12BrNO5S2/c1-5(12)4-11-18(14,15)7-3-6(9(13)16-2)17-8(7)10/h3,5,11-12H,4H2,1-2H3/t5-/m1/s1 |
| InChIKey | GZWKCPYRJSASBE-RXMQYKEDSA-N |
| XLogP | 0.96 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |