C9H10BrNO7S2 — CID 61142027
(2S)-2-[(2-bromo-5-methoxycarbonylthiophen-3-yl)sulfonylamino]-3-hydroxypropanoic acid (PubChem CID 61142027) has the molecular formula C9H10BrNO7S2 and a molecular weight of 388.22 g/mol. Its IUPAC name is (2S)-2-[(2-bromo-5-methoxycarbonylthiophen-3-yl)sulfonylamino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[(2-bromo-5-methoxycarbonylthiophen-3-yl)sulfonylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 61142027 |
| Molecular Formula | C9H10BrNO7S2 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 386.91 |
| IUPAC Name | (2S)-2-[(2-bromo-5-methoxycarbonylthiophen-3-yl)sulfonylamino]-3-hydroxypropanoic acid |
| SMILES | COC(=O)c1cc(S(=O)(=O)N[C@@H](CO)C(=O)O)c(Br)s1 |
| InChI | InChI=1S/C9H10BrNO7S2/c1-18-9(15)5-2-6(7(10)19-5)20(16,17)11-4(3-12)8(13)14/h2,4,11-12H,3H2,1H3,(H,13,14)/t4-/m0/s1 |
| InChIKey | DRLWEOJAHPHTPX-BYPYZUCNSA-N |
| XLogP | 0.02 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |