C11H14BrNO5S2 — CID 104600258
methyl 5-bromo-4-[[1-(hydroxymethyl)cyclobutyl]sulfamoyl]thiophene-2-carboxylate (PubChem CID 104600258) has the molecular formula C11H14BrNO5S2 and a molecular weight of 384.27 g/mol. Its IUPAC name is methyl 5-bromo-4-[[1-(hydroxymethyl)cyclobutyl]sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-bromo-4-[[1-(hydroxymethyl)cyclobutyl]sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 104600258 |
| Molecular Formula | C11H14BrNO5S2 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | methyl 5-bromo-4-[[1-(hydroxymethyl)cyclobutyl]sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NC2(CO)CCC2)c(Br)s1 |
| InChI | InChI=1S/C11H14BrNO5S2/c1-18-10(15)7-5-8(9(12)19-7)20(16,17)13-11(6-14)3-2-4-11/h5,13-14H,2-4,6H2,1H3 |
| InChIKey | RLNSXZKMMHHJOR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |