C11H16BrNO4S2 — CID 37476569
methyl 5-bromo-4-(pentylsulfamoyl)thiophene-2-carboxylate (PubChem CID 37476569) has the molecular formula C11H16BrNO4S2 and a molecular weight of 370.29 g/mol. Its IUPAC name is methyl 5-bromo-4-(pentylsulfamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 5-bromo-4-(pentylsulfamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 37476569 |
| Molecular Formula | C11H16BrNO4S2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | methyl 5-bromo-4-(pentylsulfamoyl)thiophene-2-carboxylate |
| SMILES | CCCCCNS(=O)(=O)c1cc(C(=O)OC)sc1Br |
| InChI | InChI=1S/C11H16BrNO4S2/c1-3-4-5-6-13-19(15,16)9-7-8(11(14)17-2)18-10(9)12/h7,13H,3-6H2,1-2H3 |
| InChIKey | NANGRCPAZBYDJI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|