C11H15BrN2O4S2 — CID 65188352
methyl 4-[(2-amino-1-cyclopropylethyl)sulfamoyl]-5-bromothiophene-2-carboxylate (PubChem CID 65188352) has the molecular formula C11H15BrN2O4S2 and a molecular weight of 383.29 g/mol. Its IUPAC name is methyl 4-[(2-amino-1-cyclopropylethyl)sulfamoyl]-5-bromothiophene-2-carboxylate.
| Compound Name | methyl 4-[(2-amino-1-cyclopropylethyl)sulfamoyl]-5-bromothiophene-2-carboxylate |
|---|---|
| PubChem CID | 65188352 |
| Molecular Formula | C11H15BrN2O4S2 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | methyl 4-[(2-amino-1-cyclopropylethyl)sulfamoyl]-5-bromothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NC(CN)C2CC2)c(Br)s1 |
| InChI | InChI=1S/C11H15BrN2O4S2/c1-18-11(15)8-4-9(10(12)19-8)20(16,17)14-7(5-13)6-2-3-6/h4,6-7,14H,2-3,5,13H2,1H3 |
| InChIKey | NDDYSZAXDLKTQW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |