C11H13BrN2O4S2 — CID 43597381
methyl 4-(3-azabicyclo[3.1.0]hexan-6-ylsulfamoyl)-5-bromothiophene-2-carboxylate (PubChem CID 43597381) has the molecular formula C11H13BrN2O4S2 and a molecular weight of 381.27 g/mol. Its IUPAC name is methyl 4-(3-azabicyclo[3.1.0]hexan-6-ylsulfamoyl)-5-bromothiophene-2-carboxylate.
| Compound Name | methyl 4-(3-azabicyclo[3.1.0]hexan-6-ylsulfamoyl)-5-bromothiophene-2-carboxylate |
|---|---|
| PubChem CID | 43597381 |
| Molecular Formula | C11H13BrN2O4S2 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | methyl 4-(3-azabicyclo[3.1.0]hexan-6-ylsulfamoyl)-5-bromothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NC2C3CNCC32)c(Br)s1 |
| InChI | InChI=1S/C11H13BrN2O4S2/c1-18-11(15)7-2-8(10(12)19-7)20(16,17)14-9-5-3-13-4-6(5)9/h2,5-6,9,13-14H,3-4H2,1H3 |
| InChIKey | OCRMOCCWKGLZNG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |