C12H15BrN2O2S — CID 43597330
N-(3-azabicyclo[3.1.0]hexan-6-yl)-2-bromo-4-methylbenzenesulfonamide (PubChem CID 43597330) has the molecular formula C12H15BrN2O2S and a molecular weight of 331.24 g/mol. Its IUPAC name is N-(3-azabicyclo[3.1.0]hexan-6-yl)-2-bromo-4-methylbenzenesulfonamide.
| Compound Name | N-(3-azabicyclo[3.1.0]hexan-6-yl)-2-bromo-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 43597330 |
| Molecular Formula | C12H15BrN2O2S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | N-(3-azabicyclo[3.1.0]hexan-6-yl)-2-bromo-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2C3CNCC32)c(Br)c1 |
| InChI | InChI=1S/C12H15BrN2O2S/c1-7-2-3-11(10(13)4-7)18(16,17)15-12-8-5-14-6-9(8)12/h2-4,8-9,12,14-15H,5-6H2,1H3 |
| InChIKey | FKCLGPCZNOZJKL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |