C10H13BrN2O2S — CID 91647304
N-(azetidin-3-yl)-2-bromo-5-methylbenzenesulfonamide (PubChem CID 91647304) has the molecular formula C10H13BrN2O2S and a molecular weight of 305.20 g/mol. Its IUPAC name is N-(azetidin-3-yl)-2-bromo-5-methylbenzenesulfonamide.
| Compound Name | N-(azetidin-3-yl)-2-bromo-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 91647304 |
| Molecular Formula | C10H13BrN2O2S |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | N-(azetidin-3-yl)-2-bromo-5-methylbenzenesulfonamide |
| SMILES | Cc1ccc(Br)c(S(=O)(=O)NC2CNC2)c1 |
| InChI | InChI=1S/C10H13BrN2O2S/c1-7-2-3-9(11)10(4-7)16(14,15)13-8-5-12-6-8/h2-4,8,12-13H,5-6H2,1H3 |
| InChIKey | JLHZOZVLZKDNSI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |