C12H18ClFN2O2S — CID 120716722
2-fluoro-5-methyl-N-[(3S)-piperidin-3-yl]benzenesulfonamide;hydrochloride (PubChem CID 120716722) has the molecular formula C12H18ClFN2O2S and a molecular weight of 308.81 g/mol. Its IUPAC name is 2-fluoro-5-methyl-N-[(3S)-piperidin-3-yl]benzenesulfonamide;hydrochloride.
| Compound Name | 2-fluoro-5-methyl-N-[(3S)-piperidin-3-yl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120716722 |
| Molecular Formula | C12H18ClFN2O2S |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-fluoro-5-methyl-N-[(3S)-piperidin-3-yl]benzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(F)c(S(=O)(=O)N[C@H]2CCCNC2)c1.Cl |
| InChI | InChI=1S/C12H17FN2O2S.ClH/c1-9-4-5-11(13)12(7-9)18(16,17)15-10-3-2-6-14-8-10;/h4-5,7,10,14-15H,2-3,6,8H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | MKAGHKLPCVGOIK-PPHPATTJSA-N |
| XLogP | 1.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |