C14H22N2O4S2 — CID 119964596
2,5-dimethyl-3-methylsulfonyl-N-piperidin-3-ylbenzenesulfonamide (PubChem CID 119964596) has the molecular formula C14H22N2O4S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2,5-dimethyl-3-methylsulfonyl-N-piperidin-3-ylbenzenesulfonamide.
| Compound Name | 2,5-dimethyl-3-methylsulfonyl-N-piperidin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 119964596 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2,5-dimethyl-3-methylsulfonyl-N-piperidin-3-ylbenzenesulfonamide |
| SMILES | Cc1cc(S(C)(=O)=O)c(C)c(S(=O)(=O)NC2CCCNC2)c1 |
| InChI | InChI=1S/C14H22N2O4S2/c1-10-7-13(21(3,17)18)11(2)14(8-10)22(19,20)16-12-5-4-6-15-9-12/h7-8,12,15-16H,4-6,9H2,1-3H3 |
| InChIKey | MFYUWNBYHCZQQC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |