C11H14BrClF2N2O2S — CID 166174754
5-bromo-2,4-difluoro-N-[(3R)-piperidin-3-yl]benzenesulfonamide;hydrochloride (PubChem CID 166174754) has the molecular formula C11H14BrClF2N2O2S and a molecular weight of 391.67 g/mol. Its IUPAC name is 5-bromo-2,4-difluoro-N-[(3R)-piperidin-3-yl]benzenesulfonamide;hydrochloride.
| Compound Name | 5-bromo-2,4-difluoro-N-[(3R)-piperidin-3-yl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 166174754 |
| Molecular Formula | C11H14BrClF2N2O2S |
| Molecular Weight | 391.67 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 5-bromo-2,4-difluoro-N-[(3R)-piperidin-3-yl]benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(N[C@@H]1CCCNC1)c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C11H13BrF2N2O2S.ClH/c12-8-4-11(10(14)5-9(8)13)19(17,18)16-7-2-1-3-15-6-7;/h4-5,7,15-16H,1-3,6H2;1H/t7-;/m1./s1 |
| InChIKey | GGRFGMJFKXXQFM-OGFXRTJISA-N |
| XLogP | 2.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.67 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|