C11H14Br2N2O2S — CID 95400193
2,5-dibromo-N-[(3R)-piperidin-3-yl]benzenesulfonamide (PubChem CID 95400193) has the molecular formula C11H14Br2N2O2S and a molecular weight of 398.12 g/mol. Its IUPAC name is 2,5-dibromo-N-[(3R)-piperidin-3-yl]benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-[(3R)-piperidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 95400193 |
| Molecular Formula | C11H14Br2N2O2S |
| Molecular Weight | 398.12 g/mol |
| Exact Mass | 395.91 |
| IUPAC Name | 2,5-dibromo-N-[(3R)-piperidin-3-yl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCCNC1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H14Br2N2O2S/c12-8-3-4-10(13)11(6-8)18(16,17)15-9-2-1-5-14-7-9/h3-4,6,9,14-15H,1-2,5,7H2/t9-/m1/s1 |
| InChIKey | CJRKKICKHWNUSU-SECBINFHSA-N |
| XLogP | 2.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.12 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |