C16H25N3O2S — CID 155201518
N-cyclopentyl-5-methyl-2-piperazin-1-ylbenzenesulfonamide (PubChem CID 155201518) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-cyclopentyl-5-methyl-2-piperazin-1-ylbenzenesulfonamide.
| Compound Name | N-cyclopentyl-5-methyl-2-piperazin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 155201518 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-cyclopentyl-5-methyl-2-piperazin-1-ylbenzenesulfonamide |
| SMILES | Cc1ccc(N2CCNCC2)c(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C16H25N3O2S/c1-13-6-7-15(19-10-8-17-9-11-19)16(12-13)22(20,21)18-14-4-2-3-5-14/h6-7,12,14,17-18H,2-5,8-11H2,1H3 |
| InChIKey | VAEFWGZTFYCYTA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |