C11H17ClN2O4S2 — CID 120874654
methyl 4-methyl-3-(pyrrolidin-3-ylsulfamoyl)thiophene-2-carboxylate;hydrochloride (PubChem CID 120874654) has the molecular formula C11H17ClN2O4S2 and a molecular weight of 340.85 g/mol. Its IUPAC name is methyl 4-methyl-3-(pyrrolidin-3-ylsulfamoyl)thiophene-2-carboxylate;hydrochloride.
| Compound Name | methyl 4-methyl-3-(pyrrolidin-3-ylsulfamoyl)thiophene-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 120874654 |
| Molecular Formula | C11H17ClN2O4S2 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | methyl 4-methyl-3-(pyrrolidin-3-ylsulfamoyl)thiophene-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)NC1CCNC1.Cl |
| InChI | InChI=1S/C11H16N2O4S2.ClH/c1-7-6-18-9(11(14)17-2)10(7)19(15,16)13-8-3-4-12-5-8;/h6,8,12-13H,3-5H2,1-2H3;1H |
| InChIKey | ZJCMRKNHPDSNSD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |