C13H19NO4S3 — CID 102794883
methyl 4-methyl-3-[(3-methylsulfanylcyclopentyl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 102794883) has the molecular formula C13H19NO4S3 and a molecular weight of 349.50 g/mol. Its IUPAC name is methyl 4-methyl-3-[(3-methylsulfanylcyclopentyl)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[(3-methylsulfanylcyclopentyl)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 102794883 |
| Molecular Formula | C13H19NO4S3 |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | methyl 4-methyl-3-[(3-methylsulfanylcyclopentyl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)NC1CCC(SC)C1 |
| InChI | InChI=1S/C13H19NO4S3/c1-8-7-20-11(13(15)18-2)12(8)21(16,17)14-9-4-5-10(6-9)19-3/h7,9-10,14H,4-6H2,1-3H3 |
| InChIKey | IZJFFWBRWYECEC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |