C12H17NO5S3 — CID 102749287
methyl 4-methyl-3-[(1-oxothian-4-yl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 102749287) has the molecular formula C12H17NO5S3 and a molecular weight of 351.47 g/mol. Its IUPAC name is methyl 4-methyl-3-[(1-oxothian-4-yl)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[(1-oxothian-4-yl)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 102749287 |
| Molecular Formula | C12H17NO5S3 |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | methyl 4-methyl-3-[(1-oxothian-4-yl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)NC1CCS(=O)CC1 |
| InChI | InChI=1S/C12H17NO5S3/c1-8-7-19-10(12(14)18-2)11(8)21(16,17)13-9-3-5-20(15)6-4-9/h7,9,13H,3-6H2,1-2H3 |
| InChIKey | KJARFUIHXJBCBT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |