C13H21NO4S2 — CID 102749364
methyl 3-(2-ethylbutylsulfamoyl)-4-methylthiophene-2-carboxylate (PubChem CID 102749364) has the molecular formula C13H21NO4S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is methyl 3-(2-ethylbutylsulfamoyl)-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-(2-ethylbutylsulfamoyl)-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 102749364 |
| Molecular Formula | C13H21NO4S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | methyl 3-(2-ethylbutylsulfamoyl)-4-methylthiophene-2-carboxylate |
| SMILES | CCC(CC)CNS(=O)(=O)c1c(C)csc1C(=O)OC |
| InChI | InChI=1S/C13H21NO4S2/c1-5-10(6-2)7-14-20(16,17)12-9(3)8-19-11(12)13(15)18-4/h8,10,14H,5-7H2,1-4H3 |
| InChIKey | KKDGQWCXFVIRQM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |