C13H22N2O4S2 — CID 102748597
methyl 3-[[2-(dimethylamino)-2-methylpropyl]sulfamoyl]-4-methylthiophene-2-carboxylate (PubChem CID 102748597) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is methyl 3-[[2-(dimethylamino)-2-methylpropyl]sulfamoyl]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(dimethylamino)-2-methylpropyl]sulfamoyl]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 102748597 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | methyl 3-[[2-(dimethylamino)-2-methylpropyl]sulfamoyl]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)NCC(C)(C)N(C)C |
| InChI | InChI=1S/C13H22N2O4S2/c1-9-7-20-10(12(16)19-6)11(9)21(17,18)14-8-13(2,3)15(4)5/h7,14H,8H2,1-6H3 |
| InChIKey | LFKRURJGOKAATR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |