C14H22N2O4S2 — CID 120874294
methyl 3-[(1-aminocyclohexyl)methylsulfamoyl]-4-methylthiophene-2-carboxylate (PubChem CID 120874294) has the molecular formula C14H22N2O4S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl 3-[(1-aminocyclohexyl)methylsulfamoyl]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(1-aminocyclohexyl)methylsulfamoyl]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 120874294 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | methyl 3-[(1-aminocyclohexyl)methylsulfamoyl]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)NCC1(N)CCCCC1 |
| InChI | InChI=1S/C14H22N2O4S2/c1-10-8-21-11(13(17)20-2)12(10)22(18,19)16-9-14(15)6-4-3-5-7-14/h8,16H,3-7,9,15H2,1-2H3 |
| InChIKey | IEXNJPLIAMSCCP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |