C11H13NO4S2 — CID 102748829
methyl 3-(but-3-ynylsulfamoyl)-4-methylthiophene-2-carboxylate (PubChem CID 102748829) has the molecular formula C11H13NO4S2 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl 3-(but-3-ynylsulfamoyl)-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-(but-3-ynylsulfamoyl)-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 102748829 |
| Molecular Formula | C11H13NO4S2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | methyl 3-(but-3-ynylsulfamoyl)-4-methylthiophene-2-carboxylate |
| SMILES | C#CCCNS(=O)(=O)c1c(C)csc1C(=O)OC |
| InChI | InChI=1S/C11H13NO4S2/c1-4-5-6-12-18(14,15)10-8(2)7-17-9(10)11(13)16-3/h1,7,12H,5-6H2,2-3H3 |
| InChIKey | VNCOTGAYWOPNNH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|