C8H10N2O5S2 — CID 140994408
methyl 3-(carbamoylsulfamoyl)-4-methylthiophene-2-carboxylate (PubChem CID 140994408) has the molecular formula C8H10N2O5S2 and a molecular weight of 278.31 g/mol. Its IUPAC name is methyl 3-(carbamoylsulfamoyl)-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-(carbamoylsulfamoyl)-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 140994408 |
| Molecular Formula | C8H10N2O5S2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | methyl 3-(carbamoylsulfamoyl)-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)NC(N)=O |
| InChI | InChI=1S/C8H10N2O5S2/c1-4-3-16-5(7(11)15-2)6(4)17(13,14)10-8(9)12/h3H,1-2H3,(H3,9,10,12) |
| InChIKey | GCEINQMBMDDENK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |