C11H11N3O4S2 — CID 102794851
methyl 4-methyl-3-(pyrimidin-5-ylsulfamoyl)thiophene-2-carboxylate (PubChem CID 102794851) has the molecular formula C11H11N3O4S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is methyl 4-methyl-3-(pyrimidin-5-ylsulfamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-(pyrimidin-5-ylsulfamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 102794851 |
| Molecular Formula | C11H11N3O4S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | methyl 4-methyl-3-(pyrimidin-5-ylsulfamoyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)Nc1cncnc1 |
| InChI | InChI=1S/C11H11N3O4S2/c1-7-5-19-9(11(15)18-2)10(7)20(16,17)14-8-3-12-6-13-4-8/h3-6,14H,1-2H3 |
| InChIKey | ZQHAKSZHBGWHSZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |