C10H12ClNO4S2 — CID 102749254
methyl 3-(2-chloroprop-2-enylsulfamoyl)-4-methylthiophene-2-carboxylate (PubChem CID 102749254) has the molecular formula C10H12ClNO4S2 and a molecular weight of 309.80 g/mol. Its IUPAC name is methyl 3-(2-chloroprop-2-enylsulfamoyl)-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-(2-chloroprop-2-enylsulfamoyl)-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 102749254 |
| Molecular Formula | C10H12ClNO4S2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | methyl 3-(2-chloroprop-2-enylsulfamoyl)-4-methylthiophene-2-carboxylate |
| SMILES | C=C(Cl)CNS(=O)(=O)c1c(C)csc1C(=O)OC |
| InChI | InChI=1S/C10H12ClNO4S2/c1-6-5-17-8(10(13)16-3)9(6)18(14,15)12-4-7(2)11/h5,12H,2,4H2,1,3H3 |
| InChIKey | YLJBZJOWQWQYNH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |