C12H12ClNO4S3 — CID 102748842
methyl 3-[(5-chlorothiophen-2-yl)methylsulfamoyl]-4-methylthiophene-2-carboxylate (PubChem CID 102748842) has the molecular formula C12H12ClNO4S3 and a molecular weight of 365.89 g/mol. Its IUPAC name is methyl 3-[(5-chlorothiophen-2-yl)methylsulfamoyl]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(5-chlorothiophen-2-yl)methylsulfamoyl]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 102748842 |
| Molecular Formula | C12H12ClNO4S3 |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | methyl 3-[(5-chlorothiophen-2-yl)methylsulfamoyl]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H12ClNO4S3/c1-7-6-19-10(12(15)18-2)11(7)21(16,17)14-5-8-3-4-9(13)20-8/h3-4,6,14H,5H2,1-2H3 |
| InChIKey | KJYHEFGZSQIHNI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |