C11H10ClNO4S3 — CID 10383342
methyl 3-[(5-chlorothiophen-2-yl)sulfonylamino]-4-methylthiophene-2-carboxylate (PubChem CID 10383342) has the molecular formula C11H10ClNO4S3 and a molecular weight of 351.86 g/mol. Its IUPAC name is methyl 3-[(5-chlorothiophen-2-yl)sulfonylamino]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(5-chlorothiophen-2-yl)sulfonylamino]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 10383342 |
| Molecular Formula | C11H10ClNO4S3 |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | methyl 3-[(5-chlorothiophen-2-yl)sulfonylamino]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H10ClNO4S3/c1-6-5-18-10(11(14)17-2)9(6)13-20(15,16)8-4-3-7(12)19-8/h3-5,13H,1-2H3 |
| InChIKey | JJJODTHMJROBAI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |