C11H13N3O4S2 — CID 114916099
methyl 4-methyl-3-[(2-methyl-1H-imidazol-5-yl)sulfonylamino]thiophene-2-carboxylate (PubChem CID 114916099) has the molecular formula C11H13N3O4S2 and a molecular weight of 315.38 g/mol. Its IUPAC name is methyl 4-methyl-3-[(2-methyl-1H-imidazol-5-yl)sulfonylamino]thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[(2-methyl-1H-imidazol-5-yl)sulfonylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 114916099 |
| Molecular Formula | C11H13N3O4S2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | methyl 4-methyl-3-[(2-methyl-1H-imidazol-5-yl)sulfonylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NS(=O)(=O)c1cnc(C)[nH]1 |
| InChI | InChI=1S/C11H13N3O4S2/c1-6-5-19-10(11(15)18-3)9(6)14-20(16,17)8-4-12-7(2)13-8/h4-5,14H,1-3H3,(H,12,13) |
| InChIKey | YBBSMBGSJBRGRV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |