C11H18N2O4S2 — CID 114916462
methyl 4-methyl-3-[[methyl(propan-2-yl)sulfamoyl]amino]thiophene-2-carboxylate (PubChem CID 114916462) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is methyl 4-methyl-3-[[methyl(propan-2-yl)sulfamoyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[[methyl(propan-2-yl)sulfamoyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 114916462 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | methyl 4-methyl-3-[[methyl(propan-2-yl)sulfamoyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NS(=O)(=O)N(C)C(C)C |
| InChI | InChI=1S/C11H18N2O4S2/c1-7(2)13(4)19(15,16)12-9-8(3)6-18-10(9)11(14)17-5/h6-7,12H,1-5H3 |
| InChIKey | CMAWFFMBONVMND-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |