C9H8Cl3NO3S — CID 2807911
methyl 4-methyl-3-[(2,2,2-trichloroacetyl)amino]thiophene-2-carboxylate (PubChem CID 2807911) has the molecular formula C9H8Cl3NO3S and a molecular weight of 316.59 g/mol. Its IUPAC name is methyl 4-methyl-3-[(2,2,2-trichloroacetyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[(2,2,2-trichloroacetyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2807911 |
| Molecular Formula | C9H8Cl3NO3S |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 314.93 |
| IUPAC Name | methyl 4-methyl-3-[(2,2,2-trichloroacetyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H8Cl3NO3S/c1-4-3-17-6(7(14)16-2)5(4)13-8(15)9(10,11)12/h3H,1-2H3,(H,13,15) |
| InChIKey | NHYONGWGGBODOX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|