C13H11NO5S — CID 114916262
methyl 4-methyl-3-[(6-oxopyran-3-carbonyl)amino]thiophene-2-carboxylate (PubChem CID 114916262) has the molecular formula C13H11NO5S and a molecular weight of 293.30 g/mol. Its IUPAC name is methyl 4-methyl-3-[(6-oxopyran-3-carbonyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[(6-oxopyran-3-carbonyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 114916262 |
| Molecular Formula | C13H11NO5S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | methyl 4-methyl-3-[(6-oxopyran-3-carbonyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NC(=O)c1ccc(=O)oc1 |
| InChI | InChI=1S/C13H11NO5S/c1-7-6-20-11(13(17)18-2)10(7)14-12(16)8-3-4-9(15)19-5-8/h3-6H,1-2H3,(H,14,16) |
| InChIKey | LXJOHAXDPBNZRE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |