C15H14ClNO3S — CID 102610428
methyl 3-[(4-chloro-2-methylbenzoyl)amino]-4-methylthiophene-2-carboxylate (PubChem CID 102610428) has the molecular formula C15H14ClNO3S and a molecular weight of 323.80 g/mol. Its IUPAC name is methyl 3-[(4-chloro-2-methylbenzoyl)amino]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(4-chloro-2-methylbenzoyl)amino]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 102610428 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | methyl 3-[(4-chloro-2-methylbenzoyl)amino]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NC(=O)c1ccc(Cl)cc1C |
| InChI | InChI=1S/C15H14ClNO3S/c1-8-6-10(16)4-5-11(8)14(18)17-12-9(2)7-21-13(12)15(19)20-3/h4-7H,1-3H3,(H,17,18) |
| InChIKey | LDFOJINITUASKP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |