C14H11BrClNO3S — CID 102610456
methyl 3-[(2-bromo-4-chlorobenzoyl)amino]-4-methylthiophene-2-carboxylate (PubChem CID 102610456) has the molecular formula C14H11BrClNO3S and a molecular weight of 388.67 g/mol. Its IUPAC name is methyl 3-[(2-bromo-4-chlorobenzoyl)amino]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(2-bromo-4-chlorobenzoyl)amino]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 102610456 |
| Molecular Formula | C14H11BrClNO3S |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | methyl 3-[(2-bromo-4-chlorobenzoyl)amino]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NC(=O)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C14H11BrClNO3S/c1-7-6-21-12(14(19)20-2)11(7)17-13(18)9-4-3-8(16)5-10(9)15/h3-6H,1-2H3,(H,17,18) |
| InChIKey | OKLVPEWDVKKFLA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |