C14H13ClN2O3S — CID 56763731
methyl 3-[(4-chlorophenyl)carbamoylamino]-4-methylthiophene-2-carboxylate (PubChem CID 56763731) has the molecular formula C14H13ClN2O3S and a molecular weight of 324.79 g/mol. Its IUPAC name is methyl 3-[(4-chlorophenyl)carbamoylamino]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(4-chlorophenyl)carbamoylamino]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 56763731 |
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | methyl 3-[(4-chlorophenyl)carbamoylamino]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H13ClN2O3S/c1-8-7-21-12(13(18)20-2)11(8)17-14(19)16-10-5-3-9(15)4-6-10/h3-7H,1-2H3,(H2,16,17,19) |
| InChIKey | LKHBDHPFRQKVPM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |