C13H11Cl2NO2S — CID 57017185
methyl 3-(2,6-dichloroanilino)-4-methylthiophene-2-carboxylate (PubChem CID 57017185) has the molecular formula C13H11Cl2NO2S and a molecular weight of 316.21 g/mol. Its IUPAC name is methyl 3-(2,6-dichloroanilino)-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-(2,6-dichloroanilino)-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 57017185 |
| Molecular Formula | C13H11Cl2NO2S |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | methyl 3-(2,6-dichloroanilino)-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H11Cl2NO2S/c1-7-6-19-12(13(17)18-2)10(7)16-11-8(14)4-3-5-9(11)15/h3-6,16H,1-2H3 |
| InChIKey | DZPAIFTTYZTVMO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |