C13H9Cl2NO3S — CID 70573374
2-[3-(2,6-dichloroanilino)-4-methylthiophen-2-yl]-2-oxoacetic acid (PubChem CID 70573374) has the molecular formula C13H9Cl2NO3S and a molecular weight of 330.19 g/mol. Its IUPAC name is 2-[3-(2,6-dichloroanilino)-4-methylthiophen-2-yl]-2-oxoacetic acid.
| Compound Name | 2-[3-(2,6-dichloroanilino)-4-methylthiophen-2-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 70573374 |
| Molecular Formula | C13H9Cl2NO3S |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 2-[3-(2,6-dichloroanilino)-4-methylthiophen-2-yl]-2-oxoacetic acid |
| SMILES | Cc1csc(C(=O)C(=O)O)c1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H9Cl2NO3S/c1-6-5-20-12(11(17)13(18)19)9(6)16-10-7(14)3-2-4-8(10)15/h2-5,16H,1H3,(H,18,19) |
| InChIKey | GHNAUCQJEAXYSE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|