C13H11FN2O3S — CID 114915398
methyl 3-[(6-fluoropyridine-2-carbonyl)amino]-4-methylthiophene-2-carboxylate (PubChem CID 114915398) has the molecular formula C13H11FN2O3S and a molecular weight of 294.31 g/mol. Its IUPAC name is methyl 3-[(6-fluoropyridine-2-carbonyl)amino]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(6-fluoropyridine-2-carbonyl)amino]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 114915398 |
| Molecular Formula | C13H11FN2O3S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | methyl 3-[(6-fluoropyridine-2-carbonyl)amino]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NC(=O)c1cccc(F)n1 |
| InChI | InChI=1S/C13H11FN2O3S/c1-7-6-20-11(13(18)19-2)10(7)16-12(17)8-4-3-5-9(14)15-8/h3-6H,1-2H3,(H,16,17) |
| InChIKey | XEMYJRIKZXFSGT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|