C14H13NO4S — CID 114915804
methyl 3-[(3-hydroxybenzoyl)amino]-4-methylthiophene-2-carboxylate (PubChem CID 114915804) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is methyl 3-[(3-hydroxybenzoyl)amino]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(3-hydroxybenzoyl)amino]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 114915804 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | methyl 3-[(3-hydroxybenzoyl)amino]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C14H13NO4S/c1-8-7-20-12(14(18)19-2)11(8)15-13(17)9-4-3-5-10(16)6-9/h3-7,16H,1-2H3,(H,15,17) |
| InChIKey | DJPCLTKVDUTLDM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |