C10H10N4O3S — CID 114916114
methyl 4-methyl-3-(2H-triazole-4-carbonylamino)thiophene-2-carboxylate (PubChem CID 114916114) has the molecular formula C10H10N4O3S and a molecular weight of 266.28 g/mol. Its IUPAC name is methyl 4-methyl-3-(2H-triazole-4-carbonylamino)thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-(2H-triazole-4-carbonylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 114916114 |
| Molecular Formula | C10H10N4O3S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | methyl 4-methyl-3-(2H-triazole-4-carbonylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C10H10N4O3S/c1-5-4-18-8(10(16)17-2)7(5)12-9(15)6-3-11-14-13-6/h3-4H,1-2H3,(H,12,15)(H,11,13,14) |
| InChIKey | HASHWIZHIZUCDW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |