C14H17N3O3S — CID 114916137
methyl 3-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-4-methylthiophene-2-carboxylate (PubChem CID 114916137) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is methyl 3-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 114916137 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | methyl 3-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-4-methylthiophene-2-carboxylate |
| SMILES | CCn1nc(C)cc1C(=O)Nc1c(C)csc1C(=O)OC |
| InChI | InChI=1S/C14H17N3O3S/c1-5-17-10(6-9(3)16-17)13(18)15-11-8(2)7-21-12(11)14(19)20-4/h6-7H,5H2,1-4H3,(H,15,18) |
| InChIKey | HDONSBFAXLYRLL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |